C13H10Br2N2O3S — CID 1286583
4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]benzenesulfonamide (PubChem CID 1286583) has the molecular formula C13H10Br2N2O3S and a molecular weight of 434.11 g/mol. Its IUPAC name is 4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]benzenesulfonamide.
| Compound Name | 4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 1286583 |
| Molecular Formula | C13H10Br2N2O3S |
| Molecular Weight | 434.11 g/mol |
| Exact Mass | 431.88 |
| IUPAC Name | 4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(/N=C/c2cc(Br)cc(Br)c2O)cc1 |
| InChI | InChI=1S/C13H10Br2N2O3S/c14-9-5-8(13(18)12(15)6-9)7-17-10-1-3-11(4-2-10)21(16,19)20/h1-7,18H,(H2,16,19,20)/b17-7+ |
| InChIKey | HKDCGILVWMDWEN-REZTVBANSA-N |
| XLogP | 3.32 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.11 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|