C20H17N5OS2 — CID 127027846
2-(5-quinolin-6-yl-1,3,4-oxadiazol-2-yl)ethyl N-(pyridin-3-ylmethyl)carbamodithioate (PubChem CID 127027846) has the molecular formula C20H17N5OS2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 2-(5-quinolin-6-yl-1,3,4-oxadiazol-2-yl)ethyl N-(pyridin-3-ylmethyl)carbamodithioate.
| Compound Name | 2-(5-quinolin-6-yl-1,3,4-oxadiazol-2-yl)ethyl N-(pyridin-3-ylmethyl)carbamodithioate |
|---|---|
| PubChem CID | 127027846 |
| Molecular Formula | C20H17N5OS2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 2-(5-quinolin-6-yl-1,3,4-oxadiazol-2-yl)ethyl N-(pyridin-3-ylmethyl)carbamodithioate |
| SMILES | S=C(NCc1cccnc1)SCCc1nnc(-c2ccc3ncccc3c2)o1 |
| InChI | InChI=1S/C20H17N5OS2/c27-20(23-13-14-3-1-8-21-12-14)28-10-7-18-24-25-19(26-18)16-5-6-17-15(11-16)4-2-9-22-17/h1-6,8-9,11-12H,7,10,13H2,(H,23,27) |
| InChIKey | IAYRYHBPFMBVNS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_carbam_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|