C28H28NO8P — CID 127028434
methyl (2S)-2-[[[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-phenoxyphosphoryl]amino]-4-methylpentanoate (PubChem CID 127028434) has the molecular formula C28H28NO8P and a molecular weight of 537.51 g/mol. Its IUPAC name is methyl (2S)-2-[[[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-phenoxyphosphoryl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[[[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-phenoxyphosphoryl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 127028434 |
| Molecular Formula | C28H28NO8P |
| Molecular Weight | 537.51 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | methyl (2S)-2-[[[3-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-phenoxyphosphoryl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NP(=O)(Oc1ccccc1)Oc1ccc2c(=O)c(-c3ccc(O)cc3)coc2c1 |
| InChI | InChI=1S/C28H28NO8P/c1-18(2)15-25(28(32)34-3)29-38(33,36-21-7-5-4-6-8-21)37-22-13-14-23-26(16-22)35-17-24(27(23)31)19-9-11-20(30)12-10-19/h4-14,16-18,25,30H,15H2,1-3H3,(H,29,33)/t25-,38?/m0/s1 |
| InChIKey | QUYKAYFDNWAECP-RAMHPWKZSA-N |
| XLogP | 5.91 |
| TPSA | 124.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|