C19H13NO3S — CID 127029491
4-[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]benzamide (PubChem CID 127029491) has the molecular formula C19H13NO3S and a molecular weight of 335.38 g/mol. Its IUPAC name is 4-[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]benzamide.
| Compound Name | 4-[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 127029491 |
| Molecular Formula | C19H13NO3S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 4-[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]benzamide |
| SMILES | NC(=O)c1ccc(-c2ccc(-c3ccc4c(c3)COC4=O)s2)cc1 |
| InChI | InChI=1S/C19H13NO3S/c20-18(21)12-3-1-11(2-4-12)16-7-8-17(24-16)13-5-6-15-14(9-13)10-23-19(15)22/h1-9H,10H2,(H2,20,21) |
| InChIKey | RQUHNRZOIBFSHS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |