C17H11NO4S — CID 53261773
(3Z)-3-[[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 53261773) has the molecular formula C17H11NO4S and a molecular weight of 325.35 g/mol. Its IUPAC name is (3Z)-3-[[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3Z)-3-[[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 53261773 |
| Molecular Formula | C17H11NO4S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | (3Z)-3-[[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C/c2ccc(-c3ccc4c(c3)COC4=O)s2)C(=O)N1 |
| InChI | InChI=1S/C17H11NO4S/c19-15-7-10(16(20)18-15)6-12-2-4-14(23-12)9-1-3-13-11(5-9)8-22-17(13)21/h1-6H,7-8H2,(H,18,19,20)/b10-6- |
| InChIKey | ZLXGPZCIOWJNNG-POHAHGRESA-N |
| XLogP | 2.52 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|