C16H9NO3S3 — CID 57399611
(5E)-5-[[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 57399611) has the molecular formula C16H9NO3S3 and a molecular weight of 359.45 g/mol. Its IUPAC name is (5E)-5-[[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 57399611 |
| Molecular Formula | C16H9NO3S3 |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | (5E)-5-[[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C/c1ccc(-c2ccc3c(c2)COC3=O)s1 |
| InChI | InChI=1S/C16H9NO3S3/c18-14-13(23-16(21)17-14)6-10-2-4-12(22-10)8-1-3-11-9(5-8)7-20-15(11)19/h1-6H,7H2,(H,17,18,21)/b13-6+ |
| InChIKey | AIDUBGRGVJKHHW-AWNIVKPZSA-N |
| XLogP | 3.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|