C20H15NO3S — CID 127029494
N-methyl-4-[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]benzamide (PubChem CID 127029494) has the molecular formula C20H15NO3S and a molecular weight of 349.41 g/mol. Its IUPAC name is N-methyl-4-[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]benzamide.
| Compound Name | N-methyl-4-[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 127029494 |
| Molecular Formula | C20H15NO3S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | N-methyl-4-[5-(1-oxo-3H-2-benzofuran-5-yl)thiophen-2-yl]benzamide |
| SMILES | CNC(=O)c1ccc(-c2ccc(-c3ccc4c(c3)COC4=O)s2)cc1 |
| InChI | InChI=1S/C20H15NO3S/c1-21-19(22)13-4-2-12(3-5-13)17-8-9-18(25-17)14-6-7-16-15(10-14)11-24-20(16)23/h2-10H,11H2,1H3,(H,21,22) |
| InChIKey | OHXZQRWUUVCCHR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |