C21H20N8O — CID 127029598
2-(2-aminopyrimidin-5-yl)-4-morpholin-4-yl-N-pyridin-2-ylquinazolin-8-amine (PubChem CID 127029598) has the molecular formula C21H20N8O and a molecular weight of 400.45 g/mol. Its IUPAC name is 2-(2-aminopyrimidin-5-yl)-4-morpholin-4-yl-N-pyridin-2-ylquinazolin-8-amine.
| Compound Name | 2-(2-aminopyrimidin-5-yl)-4-morpholin-4-yl-N-pyridin-2-ylquinazolin-8-amine |
|---|---|
| PubChem CID | 127029598 |
| Molecular Formula | C21H20N8O |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-(2-aminopyrimidin-5-yl)-4-morpholin-4-yl-N-pyridin-2-ylquinazolin-8-amine |
| SMILES | Nc1ncc(-c2nc(N3CCOCC3)c3cccc(Nc4ccccn4)c3n2)cn1 |
| InChI | InChI=1S/C21H20N8O/c22-21-24-12-14(13-25-21)19-27-18-15(20(28-19)29-8-10-30-11-9-29)4-3-5-16(18)26-17-6-1-2-7-23-17/h1-7,12-13H,8-11H2,(H,23,26)(H2,22,24,25) |
| InChIKey | PVRCAZFIRNQVFX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 114.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |