C27H28F3N7O2S — CID 138479882
5-[8-(2-fluoroethoxy)-6-[2-fluoro-3-(3-fluoropropylsulfanylamino)phenyl]-4-morpholin-4-ylquinazolin-2-yl]pyrimidin-2-amine (PubChem CID 138479882) has the molecular formula C27H28F3N7O2S and a molecular weight of 571.63 g/mol. Its IUPAC name is 5-[8-(2-fluoroethoxy)-6-[2-fluoro-3-(3-fluoropropylsulfanylamino)phenyl]-4-morpholin-4-ylquinazolin-2-yl]pyrimidin-2-amine.
| Compound Name | 5-[8-(2-fluoroethoxy)-6-[2-fluoro-3-(3-fluoropropylsulfanylamino)phenyl]-4-morpholin-4-ylquinazolin-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 138479882 |
| Molecular Formula | C27H28F3N7O2S |
| Molecular Weight | 571.63 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | 5-[8-(2-fluoroethoxy)-6-[2-fluoro-3-(3-fluoropropylsulfanylamino)phenyl]-4-morpholin-4-ylquinazolin-2-yl]pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2nc(N3CCOCC3)c3cc(-c4cccc(NSCCCF)c4F)cc(OCCF)c3n2)cn1 |
| InChI | InChI=1S/C27H28F3N7O2S/c28-5-2-12-40-36-21-4-1-3-19(23(21)30)17-13-20-24(22(14-17)39-9-6-29)34-25(18-15-32-27(31)33-16-18)35-26(20)37-7-10-38-11-8-37/h1,3-4,13-16,36H,2,5-12H2,(H2,31,32,33) |
| InChIKey | ZEZRCNXMFHBGEV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 111.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.63 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|