C29H34FN7O2S — CID 144731933
N'-[5-[6-[2-fluoro-3-(propylsulfanylamino)phenyl]-8-methoxy-4-morpholin-4-ylquinazolin-2-yl]-2-pyridinyl]ethane-1,2-diamine (PubChem CID 144731933) has the molecular formula C29H34FN7O2S and a molecular weight of 563.70 g/mol. Its IUPAC name is N'-[5-[6-[2-fluoro-3-(propylsulfanylamino)phenyl]-8-methoxy-4-morpholin-4-ylquinazolin-2-yl]-2-pyridinyl]ethane-1,2-diamine.
| Compound Name | N'-[5-[6-[2-fluoro-3-(propylsulfanylamino)phenyl]-8-methoxy-4-morpholin-4-ylquinazolin-2-yl]-2-pyridinyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 144731933 |
| Molecular Formula | C29H34FN7O2S |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | N'-[5-[6-[2-fluoro-3-(propylsulfanylamino)phenyl]-8-methoxy-4-morpholin-4-ylquinazolin-2-yl]-2-pyridinyl]ethane-1,2-diamine |
| SMILES | CCCSNc1cccc(-c2cc(OC)c3nc(-c4ccc(NCCN)nc4)nc(N4CCOCC4)c3c2)c1F |
| InChI | InChI=1S/C29H34FN7O2S/c1-3-15-40-36-23-6-4-5-21(26(23)30)20-16-22-27(24(17-20)38-2)34-28(35-29(22)37-11-13-39-14-12-37)19-7-8-25(33-18-19)32-10-9-31/h4-8,16-18,36H,3,9-15,31H2,1-2H3,(H,32,33) |
| InChIKey | MKXHDTRCWFYDDB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 110.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|