C30H33F2N7OS — CID 138479619
5-[6-[2-fluoro-3-(3-fluoropropylsulfanylamino)phenyl]-4-morpholin-4-yl-8-pyrrolidin-1-ylquinazolin-2-yl]pyridin-2-amine (PubChem CID 138479619) has the molecular formula C30H33F2N7OS and a molecular weight of 577.71 g/mol. Its IUPAC name is 5-[6-[2-fluoro-3-(3-fluoropropylsulfanylamino)phenyl]-4-morpholin-4-yl-8-pyrrolidin-1-ylquinazolin-2-yl]pyridin-2-amine.
| Compound Name | 5-[6-[2-fluoro-3-(3-fluoropropylsulfanylamino)phenyl]-4-morpholin-4-yl-8-pyrrolidin-1-ylquinazolin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 138479619 |
| Molecular Formula | C30H33F2N7OS |
| Molecular Weight | 577.71 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | 5-[6-[2-fluoro-3-(3-fluoropropylsulfanylamino)phenyl]-4-morpholin-4-yl-8-pyrrolidin-1-ylquinazolin-2-yl]pyridin-2-amine |
| SMILES | Nc1ccc(-c2nc(N3CCOCC3)c3cc(-c4cccc(NSCCCF)c4F)cc(N4CCCC4)c3n2)cn1 |
| InChI | InChI=1S/C30H33F2N7OS/c31-9-4-16-41-37-24-6-3-5-22(27(24)32)21-17-23-28(25(18-21)38-10-1-2-11-38)35-29(20-7-8-26(33)34-19-20)36-30(23)39-12-14-40-15-13-39/h3,5-8,17-19,37H,1-2,4,9-16H2,(H2,33,34) |
| InChIKey | QMOSRWROYVTGOY-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.71 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|