C24H21N5O4 — CID 127029997
methyl 3-[[5-[4-(anilinomethyl)triazol-1-yl]-2-hydroxybenzoyl]amino]benzoate (PubChem CID 127029997) has the molecular formula C24H21N5O4 and a molecular weight of 443.46 g/mol. Its IUPAC name is methyl 3-[[5-[4-(anilinomethyl)triazol-1-yl]-2-hydroxybenzoyl]amino]benzoate.
| Compound Name | methyl 3-[[5-[4-(anilinomethyl)triazol-1-yl]-2-hydroxybenzoyl]amino]benzoate |
|---|---|
| PubChem CID | 127029997 |
| Molecular Formula | C24H21N5O4 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | methyl 3-[[5-[4-(anilinomethyl)triazol-1-yl]-2-hydroxybenzoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2cc(-n3cc(CNc4ccccc4)nn3)ccc2O)c1 |
| InChI | InChI=1S/C24H21N5O4/c1-33-24(32)16-6-5-9-18(12-16)26-23(31)21-13-20(10-11-22(21)30)29-15-19(27-28-29)14-25-17-7-3-2-4-8-17/h2-13,15,25,30H,14H2,1H3,(H,26,31) |
| InChIKey | BSAGYAQHAOUDAA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |