C27H20N4O6 — CID 155526327
methyl 3-[[4-[4-[(2-oxochromen-4-yl)oxymethyl]triazol-1-yl]benzoyl]amino]benzoate (PubChem CID 155526327) has the molecular formula C27H20N4O6 and a molecular weight of 496.48 g/mol. Its IUPAC name is methyl 3-[[4-[4-[(2-oxochromen-4-yl)oxymethyl]triazol-1-yl]benzoyl]amino]benzoate.
| Compound Name | methyl 3-[[4-[4-[(2-oxochromen-4-yl)oxymethyl]triazol-1-yl]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 155526327 |
| Molecular Formula | C27H20N4O6 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | methyl 3-[[4-[4-[(2-oxochromen-4-yl)oxymethyl]triazol-1-yl]benzoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2ccc(-n3cc(COc4cc(=O)oc5ccccc45)nn3)cc2)c1 |
| InChI | InChI=1S/C27H20N4O6/c1-35-27(34)18-5-4-6-19(13-18)28-26(33)17-9-11-21(12-10-17)31-15-20(29-30-31)16-36-24-14-25(32)37-23-8-3-2-7-22(23)24/h2-15H,16H2,1H3,(H,28,33) |
| InChIKey | WTWKOMMURXBOGF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|