C27H22N4O6 — CID 155522818
N-(2,5-dimethoxyphenyl)-4-[4-[(2-oxochromen-4-yl)oxymethyl]triazol-1-yl]benzamide (PubChem CID 155522818) has the molecular formula C27H22N4O6 and a molecular weight of 498.50 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-4-[4-[(2-oxochromen-4-yl)oxymethyl]triazol-1-yl]benzamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-4-[4-[(2-oxochromen-4-yl)oxymethyl]triazol-1-yl]benzamide |
|---|---|
| PubChem CID | 155522818 |
| Molecular Formula | C27H22N4O6 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-4-[4-[(2-oxochromen-4-yl)oxymethyl]triazol-1-yl]benzamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2ccc(-n3cc(COc4cc(=O)oc5ccccc45)nn3)cc2)c1 |
| InChI | InChI=1S/C27H22N4O6/c1-34-20-11-12-24(35-2)22(13-20)28-27(33)17-7-9-19(10-8-17)31-15-18(29-30-31)16-36-25-14-26(32)37-23-6-4-3-5-21(23)25/h3-15H,16H2,1-2H3,(H,28,33) |
| InChIKey | PXHIMODMRGFUBD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|