C35H33N3O7 — CID 127046543
4-[4-[4-[[2-methoxy-4-[(1E,4E)-5-(3-methoxyphenyl)-3-oxopenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]butoxy]chromen-2-one (PubChem CID 127046543) has the molecular formula C35H33N3O7 and a molecular weight of 607.66 g/mol. Its IUPAC name is 4-[4-[4-[[2-methoxy-4-[(1E,4E)-5-(3-methoxyphenyl)-3-oxopenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]butoxy]chromen-2-one.
| Compound Name | 4-[4-[4-[[2-methoxy-4-[(1E,4E)-5-(3-methoxyphenyl)-3-oxopenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]butoxy]chromen-2-one |
|---|---|
| PubChem CID | 127046543 |
| Molecular Formula | C35H33N3O7 |
| Molecular Weight | 607.66 g/mol |
| Exact Mass | 607.23 |
| IUPAC Name | 4-[4-[4-[[2-methoxy-4-[(1E,4E)-5-(3-methoxyphenyl)-3-oxopenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]butoxy]chromen-2-one |
| SMILES | COc1cccc(/C=C/C(=O)/C=C/c2ccc(OCc3cn(CCCCOc4cc(=O)oc5ccccc45)nn3)c(OC)c2)c1 |
| InChI | InChI=1S/C35H33N3O7/c1-41-29-9-7-8-25(20-29)12-15-28(39)16-13-26-14-17-32(34(21-26)42-2)44-24-27-23-38(37-36-27)18-5-6-19-43-33-22-35(40)45-31-11-4-3-10-30(31)33/h3-4,7-17,20-23H,5-6,18-19,24H2,1-2H3/b15-12+,16-13+ |
| InChIKey | GPBLVPTURVPPQW-WSGPNKEYSA-N |
| XLogP | 6.14 |
| TPSA | 114.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.66 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|