C32H28N4O6 — CID 122194394
1-[2-[4-[[2-methoxy-4-[(1E,4E)-5-(4-methoxyphenyl)-3-oxopenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]ethyl]indole-2,3-dione (PubChem CID 122194394) has the molecular formula C32H28N4O6 and a molecular weight of 564.60 g/mol. Its IUPAC name is 1-[2-[4-[[2-methoxy-4-[(1E,4E)-5-(4-methoxyphenyl)-3-oxopenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]ethyl]indole-2,3-dione.
| Compound Name | 1-[2-[4-[[2-methoxy-4-[(1E,4E)-5-(4-methoxyphenyl)-3-oxopenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]ethyl]indole-2,3-dione |
|---|---|
| PubChem CID | 122194394 |
| Molecular Formula | C32H28N4O6 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | 1-[2-[4-[[2-methoxy-4-[(1E,4E)-5-(4-methoxyphenyl)-3-oxopenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]ethyl]indole-2,3-dione |
| SMILES | COc1ccc(/C=C/C(=O)/C=C/c2ccc(OCc3cn(CCN4C(=O)C(=O)c5ccccc54)nn3)c(OC)c2)cc1 |
| InChI | InChI=1S/C32H28N4O6/c1-40-26-14-9-22(10-15-26)7-12-25(37)13-8-23-11-16-29(30(19-23)41-2)42-21-24-20-35(34-33-24)17-18-36-28-6-4-3-5-27(28)31(38)32(36)39/h3-16,19-20H,17-18,21H2,1-2H3/b12-7+,13-8+ |
| InChIKey | JNEKOUKAVZGQQR-INOXDZRUSA-N |
| XLogP | 4.40 |
| TPSA | 112.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|