C29H23ClN4O5S — CID 122194547
5-chloro-1-[2-[4-[[2-methoxy-4-[(1E,4E)-3-oxo-5-thiophen-2-ylpenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]ethyl]indole-2,3-dione (PubChem CID 122194547) has the molecular formula C29H23ClN4O5S and a molecular weight of 575.05 g/mol. Its IUPAC name is 5-chloro-1-[2-[4-[[2-methoxy-4-[(1E,4E)-3-oxo-5-thiophen-2-ylpenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]ethyl]indole-2,3-dione.
| Compound Name | 5-chloro-1-[2-[4-[[2-methoxy-4-[(1E,4E)-3-oxo-5-thiophen-2-ylpenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]ethyl]indole-2,3-dione |
|---|---|
| PubChem CID | 122194547 |
| Molecular Formula | C29H23ClN4O5S |
| Molecular Weight | 575.05 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | 5-chloro-1-[2-[4-[[2-methoxy-4-[(1E,4E)-3-oxo-5-thiophen-2-ylpenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]ethyl]indole-2,3-dione |
| SMILES | COc1cc(/C=C/C(=O)/C=C/c2cccs2)ccc1OCc1cn(CCN2C(=O)C(=O)c3cc(Cl)ccc32)nn1 |
| InChI | InChI=1S/C29H23ClN4O5S/c1-38-27-15-19(4-7-22(35)8-9-23-3-2-14-40-23)5-11-26(27)39-18-21-17-33(32-31-21)12-13-34-25-10-6-20(30)16-24(25)28(36)29(34)37/h2-11,14-17H,12-13,18H2,1H3/b7-4+,9-8+ |
| InChIKey | IQHOWMRYGKYROW-NUXDXBQRSA-N |
| XLogP | 5.11 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.05 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|