C30H24N2O2 — CID 127030435
[2-imidazol-1-yl-1-(4-phenylphenyl)ethyl] 4-phenylbenzoate (PubChem CID 127030435) has the molecular formula C30H24N2O2 and a molecular weight of 444.53 g/mol. Its IUPAC name is [2-imidazol-1-yl-1-(4-phenylphenyl)ethyl] 4-phenylbenzoate.
| Compound Name | [2-imidazol-1-yl-1-(4-phenylphenyl)ethyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 127030435 |
| Molecular Formula | C30H24N2O2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | [2-imidazol-1-yl-1-(4-phenylphenyl)ethyl] 4-phenylbenzoate |
| SMILES | O=C(OC(Cn1ccnc1)c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H24N2O2/c33-30(28-17-13-26(14-18-28)24-9-5-2-6-10-24)34-29(21-32-20-19-31-22-32)27-15-11-25(12-16-27)23-7-3-1-4-8-23/h1-20,22,29H,21H2 |
| InChIKey | LXUBFWPSTMKNAD-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |