C16H11N5O3S2 — CID 127031506
3-[(5Z)-4-oxo-2-sulfanylidene-5-(tetrazolo[1,5-a]quinolin-4-ylmethylidene)-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 127031506) has the molecular formula C16H11N5O3S2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 3-[(5Z)-4-oxo-2-sulfanylidene-5-(tetrazolo[1,5-a]quinolin-4-ylmethylidene)-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5Z)-4-oxo-2-sulfanylidene-5-(tetrazolo[1,5-a]quinolin-4-ylmethylidene)-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 127031506 |
| Molecular Formula | C16H11N5O3S2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 3-[(5Z)-4-oxo-2-sulfanylidene-5-(tetrazolo[1,5-a]quinolin-4-ylmethylidene)-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)/C(=C/c2cc3ccccc3n3nnnc23)SC1=S |
| InChI | InChI=1S/C16H11N5O3S2/c22-13(23)5-6-20-15(24)12(26-16(20)25)8-10-7-9-3-1-2-4-11(9)21-14(10)17-18-19-21/h1-4,7-8H,5-6H2,(H,22,23)/b12-8- |
| InChIKey | CSDSAVSCIJMZCY-WQLSENKSSA-N |
| XLogP | 1.95 |
| TPSA | 100.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|