C16H11ClN2O3S2 — CID 134138850
3-[(5Z)-5-[(2-chloroquinolin-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 134138850) has the molecular formula C16H11ClN2O3S2 and a molecular weight of 378.86 g/mol. Its IUPAC name is 3-[(5Z)-5-[(2-chloroquinolin-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5Z)-5-[(2-chloroquinolin-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 134138850 |
| Molecular Formula | C16H11ClN2O3S2 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | 3-[(5Z)-5-[(2-chloroquinolin-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)/C(=C/c2cc3ccccc3nc2Cl)SC1=S |
| InChI | InChI=1S/C16H11ClN2O3S2/c17-14-10(7-9-3-1-2-4-11(9)18-14)8-12-15(22)19(16(23)24-12)6-5-13(20)21/h1-4,7-8H,5-6H2,(H,20,21)/b12-8- |
| InChIKey | AXCUQIGAJISBMG-WQLSENKSSA-N |
| XLogP | 3.56 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|