C26H31N3O — CID 127032420
N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-(4-tert-butylphenyl)indolizine-2-carboxamide (PubChem CID 127032420) has the molecular formula C26H31N3O and a molecular weight of 401.55 g/mol. Its IUPAC name is N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-(4-tert-butylphenyl)indolizine-2-carboxamide.
| Compound Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-(4-tert-butylphenyl)indolizine-2-carboxamide |
|---|---|
| PubChem CID | 127032420 |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-(4-tert-butylphenyl)indolizine-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(-c2cccc3cc(C(=O)N[C@H]4CN5CCC4CC5)cn23)cc1 |
| InChI | InChI=1S/C26H31N3O/c1-26(2,3)21-9-7-19(8-10-21)24-6-4-5-22-15-20(16-29(22)24)25(30)27-23-17-28-13-11-18(23)12-14-28/h4-10,15-16,18,23H,11-14,17H2,1-3H3,(H,27,30)/t23-/m0/s1 |
| InChIKey | SOEVDLFRBWQGPB-QHCPKHFHSA-N |
| XLogP | 4.73 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |