C25H33N5O2 — CID 127034464
7-[3-(azetidin-1-ylmethyl)cyclobutyl]-5-[3-(2-propoxyethoxy)phenyl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 127034464) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 7-[3-(azetidin-1-ylmethyl)cyclobutyl]-5-[3-(2-propoxyethoxy)phenyl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[3-(azetidin-1-ylmethyl)cyclobutyl]-5-[3-(2-propoxyethoxy)phenyl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 127034464 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 7-[3-(azetidin-1-ylmethyl)cyclobutyl]-5-[3-(2-propoxyethoxy)phenyl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCCOCCOc1cccc(-c2cn(C3CC(CN4CCC4)C3)c3ncnc(N)c23)c1 |
| InChI | InChI=1S/C25H33N5O2/c1-2-9-31-10-11-32-21-6-3-5-19(14-21)22-16-30(25-23(22)24(26)27-17-28-25)20-12-18(13-20)15-29-7-4-8-29/h3,5-6,14,16-18,20H,2,4,7-13,15H2,1H3,(H2,26,27,28) |
| InChIKey | TWOPWUNWGUBFRQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|