C26H36N5O3P — CID 156817017
7-[3-(azetidin-1-ylmethyl)cyclobutyl]-5-[3-(2-diethoxyphosphorylethyl)phenyl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 156817017) has the molecular formula C26H36N5O3P and a molecular weight of 497.58 g/mol. Its IUPAC name is 7-[3-(azetidin-1-ylmethyl)cyclobutyl]-5-[3-(2-diethoxyphosphorylethyl)phenyl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[3-(azetidin-1-ylmethyl)cyclobutyl]-5-[3-(2-diethoxyphosphorylethyl)phenyl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 156817017 |
| Molecular Formula | C26H36N5O3P |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 7-[3-(azetidin-1-ylmethyl)cyclobutyl]-5-[3-(2-diethoxyphosphorylethyl)phenyl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCOP(=O)(CCc1cccc(-c2cn(C3CC(CN4CCC4)C3)c3ncnc(N)c23)c1)OCC |
| InChI | InChI=1S/C26H36N5O3P/c1-3-33-35(32,34-4-2)12-9-19-7-5-8-21(13-19)23-17-31(26-24(23)25(27)28-18-29-26)22-14-20(15-22)16-30-10-6-11-30/h5,7-8,13,17-18,20,22H,3-4,6,9-12,14-16H2,1-2H3,(H2,27,28,29) |
| InChIKey | MQABDWYSXWFPDF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|