C23H30N6S — CID 156817160
7-[3-(azetidin-1-ylmethyl)cyclobutyl]-5-[3-[(ethylsulfanylamino)methyl]phenyl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 156817160) has the molecular formula C23H30N6S and a molecular weight of 422.60 g/mol. Its IUPAC name is 7-[3-(azetidin-1-ylmethyl)cyclobutyl]-5-[3-[(ethylsulfanylamino)methyl]phenyl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[3-(azetidin-1-ylmethyl)cyclobutyl]-5-[3-[(ethylsulfanylamino)methyl]phenyl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 156817160 |
| Molecular Formula | C23H30N6S |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 7-[3-(azetidin-1-ylmethyl)cyclobutyl]-5-[3-[(ethylsulfanylamino)methyl]phenyl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCSNCc1cccc(-c2cn(C3CC(CN4CCC4)C3)c3ncnc(N)c23)c1 |
| InChI | InChI=1S/C23H30N6S/c1-2-30-27-12-16-5-3-6-18(9-16)20-14-29(23-21(20)22(24)25-15-26-23)19-10-17(11-19)13-28-7-4-8-28/h3,5-6,9,14-15,17,19,27H,2,4,7-8,10-13H2,1H3,(H2,24,25,26) |
| InChIKey | HZWUZHJIDJLIGB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|