C19H21N5OS — CID 156816657
3-[4-amino-5-[3-[(methylsulfanylamino)methyl]phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclobutane-1-carbaldehyde (PubChem CID 156816657) has the molecular formula C19H21N5OS and a molecular weight of 367.48 g/mol. Its IUPAC name is 3-[4-amino-5-[3-[(methylsulfanylamino)methyl]phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclobutane-1-carbaldehyde.
| Compound Name | 3-[4-amino-5-[3-[(methylsulfanylamino)methyl]phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclobutane-1-carbaldehyde |
|---|---|
| PubChem CID | 156816657 |
| Molecular Formula | C19H21N5OS |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 3-[4-amino-5-[3-[(methylsulfanylamino)methyl]phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclobutane-1-carbaldehyde |
| SMILES | CSNCc1cccc(-c2cn(C3CC(C=O)C3)c3ncnc(N)c23)c1 |
| InChI | InChI=1S/C19H21N5OS/c1-26-23-8-12-3-2-4-14(5-12)16-9-24(15-6-13(7-15)10-25)19-17(16)18(20)21-11-22-19/h2-5,9-11,13,15,23H,6-8H2,1H3,(H2,20,21,22) |
| InChIKey | DNBQOUFXDWJHPU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|