C19H16Cl2N2O2 — CID 127036258
2-(2,4-dichlorophenyl)-2-ethoxy-N-quinolin-3-ylacetamide (PubChem CID 127036258) has the molecular formula C19H16Cl2N2O2 and a molecular weight of 375.26 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-2-ethoxy-N-quinolin-3-ylacetamide.
| Compound Name | 2-(2,4-dichlorophenyl)-2-ethoxy-N-quinolin-3-ylacetamide |
|---|---|
| PubChem CID | 127036258 |
| Molecular Formula | C19H16Cl2N2O2 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-2-ethoxy-N-quinolin-3-ylacetamide |
| SMILES | CCOC(C(=O)Nc1cnc2ccccc2c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H16Cl2N2O2/c1-2-25-18(15-8-7-13(20)10-16(15)21)19(24)23-14-9-12-5-3-4-6-17(12)22-11-14/h3-11,18H,2H2,1H3,(H,23,24) |
| InChIKey | GHRYALPXRCKSIA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |