C20H24I2N2O2S — CID 127037375
N-benzyl-N-[(3,4-dimethoxyphenyl)methyl]-5-(iodomethyl)-4,5-dihydro-1,3-thiazol-2-amine;hydroiodide (PubChem CID 127037375) has the molecular formula C20H24I2N2O2S and a molecular weight of 610.30 g/mol. Its IUPAC name is N-benzyl-N-[(3,4-dimethoxyphenyl)methyl]-5-(iodomethyl)-4,5-dihydro-1,3-thiazol-2-amine;hydroiodide.
| Compound Name | N-benzyl-N-[(3,4-dimethoxyphenyl)methyl]-5-(iodomethyl)-4,5-dihydro-1,3-thiazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 127037375 |
| Molecular Formula | C20H24I2N2O2S |
| Molecular Weight | 610.30 g/mol |
| Exact Mass | 609.96 |
| IUPAC Name | N-benzyl-N-[(3,4-dimethoxyphenyl)methyl]-5-(iodomethyl)-4,5-dihydro-1,3-thiazol-2-amine;hydroiodide |
| SMILES | COc1ccc(CN(Cc2ccccc2)C2=NCC(CI)S2)cc1OC.I |
| InChI | InChI=1S/C20H23IN2O2S.HI/c1-24-18-9-8-16(10-19(18)25-2)14-23(13-15-6-4-3-5-7-15)20-22-12-17(11-21)26-20;/h3-10,17H,11-14H2,1-2H3;1H |
| InChIKey | IXAJVSWYENRSLI-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.30 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|