C19H18KNO3 — CID 127037387
potassium (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enylidene]amino]-3-phenylpropanoate (PubChem CID 127037387) has the molecular formula C19H18KNO3 and a molecular weight of 347.46 g/mol. Its IUPAC name is potassium (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enylidene]amino]-3-phenylpropanoate.
| Compound Name | potassium (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enylidene]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 127037387 |
| Molecular Formula | C19H18KNO3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | potassium (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enylidene]amino]-3-phenylpropanoate |
| SMILES | COc1ccc(/C=C/C=N/[C@@H](Cc2ccccc2)C(=O)[O-])cc1.[K+] |
| InChI | InChI=1S/C19H19NO3.K/c1-23-17-11-9-15(10-12-17)8-5-13-20-18(19(21)22)14-16-6-3-2-4-7-16;/h2-13,18H,14H2,1H3,(H,21,22);/q;+1/p-1/b8-5+,20-13+;/t18-;/m0./s1 |
| InChIKey | ZZYMGIABPDDJAC-UHCBMESASA-M |
| XLogP | -0.86 |
| TPSA | 61.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|