C18H15ClKNO3 — CID 127036373
potassium (2S)-2-[[(E)-3-(4-chlorophenyl)prop-2-enylidene]amino]-3-(4-hydroxyphenyl)propanoate (PubChem CID 127036373) has the molecular formula C18H15ClKNO3 and a molecular weight of 367.87 g/mol. Its IUPAC name is potassium (2S)-2-[[(E)-3-(4-chlorophenyl)prop-2-enylidene]amino]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | potassium (2S)-2-[[(E)-3-(4-chlorophenyl)prop-2-enylidene]amino]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 127036373 |
| Molecular Formula | C18H15ClKNO3 |
| Molecular Weight | 367.87 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | potassium (2S)-2-[[(E)-3-(4-chlorophenyl)prop-2-enylidene]amino]-3-(4-hydroxyphenyl)propanoate |
| SMILES | O=C([O-])[C@H](Cc1ccc(O)cc1)/N=C/C=C/c1ccc(Cl)cc1.[K+] |
| InChI | InChI=1S/C18H16ClNO3.K/c19-15-7-3-13(4-8-15)2-1-11-20-17(18(22)23)12-14-5-9-16(21)10-6-14;/h1-11,17,21H,12H2,(H,22,23);/q;+1/p-1/b2-1+,20-11+;/t17-;/m0./s1 |
| InChIKey | BPEWNNWTDXHLRP-SBUNPTCBSA-M |
| XLogP | -0.51 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.87 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|