C22H24O3 — CID 3007334
4-[[4-[2-(4-hydroxyphenyl)ethenyl]phenyl]methyl]heptane-3,5-dione (PubChem CID 3007334) has the molecular formula C22H24O3 and a molecular weight of 336.43 g/mol. Its IUPAC name is 4-[[4-[2-(4-hydroxyphenyl)ethenyl]phenyl]methyl]heptane-3,5-dione.
| Compound Name | 4-[[4-[2-(4-hydroxyphenyl)ethenyl]phenyl]methyl]heptane-3,5-dione |
|---|---|
| PubChem CID | 3007334 |
| Molecular Formula | C22H24O3 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 4-[[4-[2-(4-hydroxyphenyl)ethenyl]phenyl]methyl]heptane-3,5-dione |
| SMILES | CCC(=O)C(Cc1ccc(C=Cc2ccc(O)cc2)cc1)C(=O)CC |
| InChI | InChI=1S/C22H24O3/c1-3-21(24)20(22(25)4-2)15-18-9-7-16(8-10-18)5-6-17-11-13-19(23)14-12-17/h5-14,20,23H,3-4,15H2,1-2H3 |
| InChIKey | SEWVKYXTHRJYKR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|