C14H19N2O3 — CID 59574067
CID 59574067 (PubChem CID 59574067) has the molecular formula C14H19N2O3 and a molecular weight of 263.32 g/mol.
| Compound Name | CID 59574067 |
|---|---|
| PubChem CID | 59574067 |
| Molecular Formula | C14H19N2O3 |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | — |
| SMILES | CCC(=O)[C@@H](C)NC(=O)[C@@H]([NH])Cc1ccc(O)cc1 |
| InChI | InChI=1S/C14H19N2O3/c1-3-13(18)9(2)16-14(19)12(15)8-10-4-6-11(17)7-5-10/h4-7,9,12,15,17H,3,8H2,1-2H3,(H,16,19)/t9-,12+/m1/s1 |
| InChIKey | NTONKEBLLAJAEZ-SKDRFNHKSA-N |
| XLogP | 1.07 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |