C19H18KNO4 — CID 127036372
potassium (2S)-3-(4-hydroxyphenyl)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enylidene]amino]propanoate (PubChem CID 127036372) has the molecular formula C19H18KNO4 and a molecular weight of 363.45 g/mol. Its IUPAC name is potassium (2S)-3-(4-hydroxyphenyl)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enylidene]amino]propanoate.
| Compound Name | potassium (2S)-3-(4-hydroxyphenyl)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enylidene]amino]propanoate |
|---|---|
| PubChem CID | 127036372 |
| Molecular Formula | C19H18KNO4 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | potassium (2S)-3-(4-hydroxyphenyl)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enylidene]amino]propanoate |
| SMILES | COc1ccc(/C=C/C=N/[C@@H](Cc2ccc(O)cc2)C(=O)[O-])cc1.[K+] |
| InChI | InChI=1S/C19H19NO4.K/c1-24-17-10-6-14(7-11-17)3-2-12-20-18(19(22)23)13-15-4-8-16(21)9-5-15;/h2-12,18,21H,13H2,1H3,(H,22,23);/q;+1/p-1/b3-2+,20-12+;/t18-;/m0./s1 |
| InChIKey | HRFKLJSMPSKVHX-OXPRCNRJSA-M |
| XLogP | -1.15 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|