C21H25N3OS — CID 127037786
(2Z)-2-[(E)-heptan-2-ylidenehydrazinylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 127037786) has the molecular formula C21H25N3OS and a molecular weight of 367.52 g/mol. Its IUPAC name is (2Z)-2-[(E)-heptan-2-ylidenehydrazinylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-2-[(E)-heptan-2-ylidenehydrazinylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 127037786 |
| Molecular Formula | C21H25N3OS |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | (2Z)-2-[(E)-heptan-2-ylidenehydrazinylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | CCCCC/C(C)=N/N=C1\SCC(=O)N1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C21H25N3OS/c1-3-4-5-9-16(2)22-23-21-24(20(25)15-26-21)14-18-12-8-11-17-10-6-7-13-19(17)18/h6-8,10-13H,3-5,9,14-15H2,1-2H3/b22-16+,23-21- |
| InChIKey | WHFKVXKPZSPNKO-CGRMPOQBSA-N |
| XLogP | 5.23 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|