C22H27N3OS — CID 127037788
(2Z)-3-(naphthalen-1-ylmethyl)-2-[(E)-octan-2-ylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 127037788) has the molecular formula C22H27N3OS and a molecular weight of 381.55 g/mol. Its IUPAC name is (2Z)-3-(naphthalen-1-ylmethyl)-2-[(E)-octan-2-ylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-3-(naphthalen-1-ylmethyl)-2-[(E)-octan-2-ylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 127037788 |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (2Z)-3-(naphthalen-1-ylmethyl)-2-[(E)-octan-2-ylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CCCCCC/C(C)=N/N=C1\SCC(=O)N1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C22H27N3OS/c1-3-4-5-6-10-17(2)23-24-22-25(21(26)16-27-22)15-19-13-9-12-18-11-7-8-14-20(18)19/h7-9,11-14H,3-6,10,15-16H2,1-2H3/b23-17+,24-22- |
| InChIKey | KDFQKSWCFIYXBC-XRAPFCFLSA-N |
| XLogP | 5.62 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|