C18H16O4 — CID 127037969
(2E,4E)-5-(2-hydroxy-4-methoxyphenyl)-1-(4-hydroxyphenyl)penta-2,4-dien-1-one (PubChem CID 127037969) has the molecular formula C18H16O4 and a molecular weight of 296.32 g/mol. Its IUPAC name is (2E,4E)-5-(2-hydroxy-4-methoxyphenyl)-1-(4-hydroxyphenyl)penta-2,4-dien-1-one.
| Compound Name | (2E,4E)-5-(2-hydroxy-4-methoxyphenyl)-1-(4-hydroxyphenyl)penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 127037969 |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (2E,4E)-5-(2-hydroxy-4-methoxyphenyl)-1-(4-hydroxyphenyl)penta-2,4-dien-1-one |
| SMILES | COc1ccc(/C=C/C=C/C(=O)c2ccc(O)cc2)c(O)c1 |
| InChI | InChI=1S/C18H16O4/c1-22-16-11-8-13(18(21)12-16)4-2-3-5-17(20)14-6-9-15(19)10-7-14/h2-12,19,21H,1H3/b4-2+,5-3+ |
| InChIKey | OADVRJRCYQYFCM-ZUVMSYQZSA-N |
| XLogP | 3.56 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|