C23H16N4O3S — CID 127040516
2-[[(2Z)-2-[(E)-naphthalen-1-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-3-yl]methyl]isoindole-1,3-dione (PubChem CID 127040516) has the molecular formula C23H16N4O3S and a molecular weight of 428.47 g/mol. Its IUPAC name is 2-[[(2Z)-2-[(E)-naphthalen-1-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-3-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(2Z)-2-[(E)-naphthalen-1-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-3-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 127040516 |
| Molecular Formula | C23H16N4O3S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 2-[[(2Z)-2-[(E)-naphthalen-1-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-3-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CN1C(=O)CS/C1=N\N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C23H16N4O3S/c28-20-13-31-23(25-24-12-16-8-5-7-15-6-1-2-9-17(15)16)26(20)14-27-21(29)18-10-3-4-11-19(18)22(27)30/h1-12H,13-14H2/b24-12+,25-23- |
| InChIKey | DZQVGJFYPFHQSN-IVZTXLFASA-N |
| XLogP | 3.36 |
| TPSA | 82.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|