C22H21N5O2S — CID 14661277
(2Z)-3-butyl-2-[(E)-(4-oxo-3-phenylquinazolin-2-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 14661277) has the molecular formula C22H21N5O2S and a molecular weight of 419.51 g/mol. Its IUPAC name is (2Z)-3-butyl-2-[(E)-(4-oxo-3-phenylquinazolin-2-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-3-butyl-2-[(E)-(4-oxo-3-phenylquinazolin-2-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 14661277 |
| Molecular Formula | C22H21N5O2S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (2Z)-3-butyl-2-[(E)-(4-oxo-3-phenylquinazolin-2-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CCCCN1C(=O)CS/C1=N\N=C\c1nc2ccccc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C22H21N5O2S/c1-2-3-13-26-20(28)15-30-22(26)25-23-14-19-24-18-12-8-7-11-17(18)21(29)27(19)16-9-5-4-6-10-16/h4-12,14H,2-3,13,15H2,1H3/b23-14+,25-22- |
| InChIKey | XISHGSUCAWCYPE-PXESAMTJSA-N |
| XLogP | 3.45 |
| TPSA | 79.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|