C22H20BrN5O2S — CID 14661284
(2Z)-2-[(E)-[3-(4-bromophenyl)-4-oxoquinazolin-2-yl]methylidenehydrazinylidene]-3-butyl-1,3-thiazolidin-4-one (PubChem CID 14661284) has the molecular formula C22H20BrN5O2S and a molecular weight of 498.41 g/mol. Its IUPAC name is (2Z)-2-[(E)-[3-(4-bromophenyl)-4-oxoquinazolin-2-yl]methylidenehydrazinylidene]-3-butyl-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-2-[(E)-[3-(4-bromophenyl)-4-oxoquinazolin-2-yl]methylidenehydrazinylidene]-3-butyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 14661284 |
| Molecular Formula | C22H20BrN5O2S |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | (2Z)-2-[(E)-[3-(4-bromophenyl)-4-oxoquinazolin-2-yl]methylidenehydrazinylidene]-3-butyl-1,3-thiazolidin-4-one |
| SMILES | CCCCN1C(=O)CS/C1=N\N=C\c1nc2ccccc2c(=O)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H20BrN5O2S/c1-2-3-12-27-20(29)14-31-22(27)26-24-13-19-25-18-7-5-4-6-17(18)21(30)28(19)16-10-8-15(23)9-11-16/h4-11,13H,2-3,12,14H2,1H3/b24-13+,26-22- |
| InChIKey | MNWBTCXJFUTFLJ-HGUNBPQBSA-N |
| XLogP | 4.21 |
| TPSA | 79.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|