C20H30O5 — CID 127040858
(1S,3R,4R,6R,7S,8R,10S,13S,16R)-5,5,14-trimethyl-9-methylidenetetracyclo[11.2.1.01,10.04,8]hexadec-14-ene-3,4,6,7,16-pentol (PubChem CID 127040858) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (1S,3R,4R,6R,7S,8R,10S,13S,16R)-5,5,14-trimethyl-9-methylidenetetracyclo[11.2.1.01,10.04,8]hexadec-14-ene-3,4,6,7,16-pentol.
| Compound Name | (1S,3R,4R,6R,7S,8R,10S,13S,16R)-5,5,14-trimethyl-9-methylidenetetracyclo[11.2.1.01,10.04,8]hexadec-14-ene-3,4,6,7,16-pentol |
|---|---|
| PubChem CID | 127040858 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (1S,3R,4R,6R,7S,8R,10S,13S,16R)-5,5,14-trimethyl-9-methylidenetetracyclo[11.2.1.01,10.04,8]hexadec-14-ene-3,4,6,7,16-pentol |
| SMILES | C=C1[C@@H]2[C@H](O)[C@H](O)C(C)(C)[C@@]2(O)[C@H](O)C[C@]23C=C(C)[C@H](CC[C@@H]12)[C@H]3O |
| InChI | InChI=1S/C20H30O5/c1-9-7-19-8-13(21)20(25)14(15(22)17(24)18(20,3)4)10(2)12(19)6-5-11(9)16(19)23/h7,11-17,21-25H,2,5-6,8H2,1,3-4H3/t11-,12-,13+,14+,15-,16+,17-,19+,20+/m0/s1 |
| InChIKey | OIFHQQMEVVIQFJ-CFVOLMPBSA-N |
| XLogP | 0.75 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|