C27H35N7 — CID 127040945
6-benzyl-N-[3-(4-methylpiperazin-1-yl)propyl]-2-pyridin-3-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-amine (PubChem CID 127040945) has the molecular formula C27H35N7 and a molecular weight of 457.63 g/mol. Its IUPAC name is 6-benzyl-N-[3-(4-methylpiperazin-1-yl)propyl]-2-pyridin-3-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | 6-benzyl-N-[3-(4-methylpiperazin-1-yl)propyl]-2-pyridin-3-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 127040945 |
| Molecular Formula | C27H35N7 |
| Molecular Weight | 457.63 g/mol |
| Exact Mass | 457.30 |
| IUPAC Name | 6-benzyl-N-[3-(4-methylpiperazin-1-yl)propyl]-2-pyridin-3-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-amine |
| SMILES | CN1CCN(CCCNc2nc(-c3cccnc3)nc3c2CN(Cc2ccccc2)CC3)CC1 |
| InChI | InChI=1S/C27H35N7/c1-32-15-17-33(18-16-32)13-6-12-29-27-24-21-34(20-22-7-3-2-4-8-22)14-10-25(24)30-26(31-27)23-9-5-11-28-19-23/h2-5,7-9,11,19H,6,10,12-18,20-21H2,1H3,(H,29,30,31) |
| InChIKey | CITIZFHBVALJKR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.63 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|