C17H20N8 — CID 56739355
2-pyridin-3-yl-N-[3-(1,2,4-triazol-1-yl)propyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine (PubChem CID 56739355) has the molecular formula C17H20N8 and a molecular weight of 336.40 g/mol. Its IUPAC name is 2-pyridin-3-yl-N-[3-(1,2,4-triazol-1-yl)propyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 2-pyridin-3-yl-N-[3-(1,2,4-triazol-1-yl)propyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 56739355 |
| Molecular Formula | C17H20N8 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2-pyridin-3-yl-N-[3-(1,2,4-triazol-1-yl)propyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine |
| SMILES | c1cncc(-c2nc3c(c(NCCCn4cncn4)n2)CCNC3)c1 |
| InChI | InChI=1S/C17H20N8/c1-3-13(9-18-5-1)16-23-15-10-19-7-4-14(15)17(24-16)21-6-2-8-25-12-20-11-22-25/h1,3,5,9,11-12,19H,2,4,6-8,10H2,(H,21,23,24) |
| InChIKey | QLKJOXHNPFXFJZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|