C20H28N6O — CID 56867630
1-[3-[(2-pyridin-3-yl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl)amino]propyl]piperidin-3-ol (PubChem CID 56867630) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is 1-[3-[(2-pyridin-3-yl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl)amino]propyl]piperidin-3-ol.
| Compound Name | 1-[3-[(2-pyridin-3-yl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl)amino]propyl]piperidin-3-ol |
|---|---|
| PubChem CID | 56867630 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 1-[3-[(2-pyridin-3-yl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl)amino]propyl]piperidin-3-ol |
| SMILES | OC1CCCN(CCCNc2nc(-c3cccnc3)nc3c2CCNC3)C1 |
| InChI | InChI=1S/C20H28N6O/c27-16-5-2-10-26(14-16)11-3-8-23-20-17-6-9-22-13-18(17)24-19(25-20)15-4-1-7-21-12-15/h1,4,7,12,16,22,27H,2-3,5-6,8-11,13-14H2,(H,23,24,25) |
| InChIKey | UFUQFWRFTNEBLY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|