C17H26ClN3 — CID 127041683
(10aS)-2-hexyl-1,5,10,10a-tetrahydroimidazo[1,5-b]isoquinolin-3-imine;hydrochloride (PubChem CID 127041683) has the molecular formula C17H26ClN3 and a molecular weight of 307.87 g/mol. Its IUPAC name is (10aS)-2-hexyl-1,5,10,10a-tetrahydroimidazo[1,5-b]isoquinolin-3-imine;hydrochloride.
| Compound Name | (10aS)-2-hexyl-1,5,10,10a-tetrahydroimidazo[1,5-b]isoquinolin-3-imine;hydrochloride |
|---|---|
| PubChem CID | 127041683 |
| Molecular Formula | C17H26ClN3 |
| Molecular Weight | 307.87 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | (10aS)-2-hexyl-1,5,10,10a-tetrahydroimidazo[1,5-b]isoquinolin-3-imine;hydrochloride |
| SMILES | Cl.[H]/N=C1\N(CCCCCC)C[C@@H]2Cc3ccccc3CN12 |
| InChI | InChI=1S/C17H25N3.ClH/c1-2-3-4-7-10-19-13-16-11-14-8-5-6-9-15(14)12-20(16)17(19)18;/h5-6,8-9,16,18H,2-4,7,10-13H2,1H3;1H/b18-17+;/t16-;/m0./s1 |
| InChIKey | YOZXEANSNNBQNJ-YLRVIBGRSA-N |
| XLogP | 3.67 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.87 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|