C15H25N3 — CID 127041950
(1R,2R,3R,5S)-2,6,6-trimethyl-N-[(3-methylimidazol-4-yl)methyl]bicyclo[3.1.1]heptan-3-amine (PubChem CID 127041950) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is (1R,2R,3R,5S)-2,6,6-trimethyl-N-[(3-methylimidazol-4-yl)methyl]bicyclo[3.1.1]heptan-3-amine.
| Compound Name | (1R,2R,3R,5S)-2,6,6-trimethyl-N-[(3-methylimidazol-4-yl)methyl]bicyclo[3.1.1]heptan-3-amine |
|---|---|
| PubChem CID | 127041950 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | (1R,2R,3R,5S)-2,6,6-trimethyl-N-[(3-methylimidazol-4-yl)methyl]bicyclo[3.1.1]heptan-3-amine |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1NCc1cncn1C)C2(C)C |
| InChI | InChI=1S/C15H25N3/c1-10-13-5-11(15(13,2)3)6-14(10)17-8-12-7-16-9-18(12)4/h7,9-11,13-14,17H,5-6,8H2,1-4H3/t10-,11+,13-,14-/m1/s1 |
| InChIKey | QIMJSIYIVZGWHH-ZMJPVWNMSA-N |
| XLogP | 2.58 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |