C33H47N7O6 — CID 127043111
benzyl N-[(12S,15S,18S)-15-(cyclohexylmethyl)-12-formyl-9,14,17-trioxo-1,8,13,16,21,22-hexazabicyclo[18.2.1]tricosa-20(23),21-dien-18-yl]carbamate (PubChem CID 127043111) has the molecular formula C33H47N7O6 and a molecular weight of 637.78 g/mol. Its IUPAC name is benzyl N-[(12S,15S,18S)-15-(cyclohexylmethyl)-12-formyl-9,14,17-trioxo-1,8,13,16,21,22-hexazabicyclo[18.2.1]tricosa-20(23),21-dien-18-yl]carbamate.
| Compound Name | benzyl N-[(12S,15S,18S)-15-(cyclohexylmethyl)-12-formyl-9,14,17-trioxo-1,8,13,16,21,22-hexazabicyclo[18.2.1]tricosa-20(23),21-dien-18-yl]carbamate |
|---|---|
| PubChem CID | 127043111 |
| Molecular Formula | C33H47N7O6 |
| Molecular Weight | 637.78 g/mol |
| Exact Mass | 637.36 |
| IUPAC Name | benzyl N-[(12S,15S,18S)-15-(cyclohexylmethyl)-12-formyl-9,14,17-trioxo-1,8,13,16,21,22-hexazabicyclo[18.2.1]tricosa-20(23),21-dien-18-yl]carbamate |
| SMILES | O=C[C@@H]1CCC(=O)NCCCCCCn2cc(nn2)C[C@H](NC(=O)OCc2ccccc2)C(=O)N[C@@H](CC2CCCCC2)C(=O)N1 |
| InChI | InChI=1S/C33H47N7O6/c41-22-26-15-16-30(42)34-17-9-1-2-10-18-40-21-27(38-39-40)20-29(37-33(45)46-23-25-13-7-4-8-14-25)32(44)36-28(31(43)35-26)19-24-11-5-3-6-12-24/h4,7-8,13-14,21-22,24,26,28-29H,1-3,5-6,9-12,15-20,23H2,(H,34,42)(H,35,43)(H,36,44)(H,37,45)/t26-,28-,29-/m0/s1 |
| InChIKey | ROELSVWGRFPSIO-ZXRKZBAXSA-N |
| XLogP | 2.72 |
| TPSA | 173.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.78 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|