C30H41N7O7 — CID 127043113
methyl (8S,11S,14S)-11-(cyclohexylmethyl)-5,10,13-trioxo-14-(phenylmethoxycarbonylamino)-1,4,9,12,17,18-hexazabicyclo[14.2.1]nonadeca-16(19),17-diene-8-carboxylate (PubChem CID 127043113) has the molecular formula C30H41N7O7 and a molecular weight of 611.70 g/mol. Its IUPAC name is methyl (8S,11S,14S)-11-(cyclohexylmethyl)-5,10,13-trioxo-14-(phenylmethoxycarbonylamino)-1,4,9,12,17,18-hexazabicyclo[14.2.1]nonadeca-16(19),17-diene-8-carboxylate.
| Compound Name | methyl (8S,11S,14S)-11-(cyclohexylmethyl)-5,10,13-trioxo-14-(phenylmethoxycarbonylamino)-1,4,9,12,17,18-hexazabicyclo[14.2.1]nonadeca-16(19),17-diene-8-carboxylate |
|---|---|
| PubChem CID | 127043113 |
| Molecular Formula | C30H41N7O7 |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 611.31 |
| IUPAC Name | methyl (8S,11S,14S)-11-(cyclohexylmethyl)-5,10,13-trioxo-14-(phenylmethoxycarbonylamino)-1,4,9,12,17,18-hexazabicyclo[14.2.1]nonadeca-16(19),17-diene-8-carboxylate |
| SMILES | COC(=O)[C@@H]1CCC(=O)NCCn2cc(nn2)C[C@H](NC(=O)OCc2ccccc2)C(=O)N[C@@H](CC2CCCCC2)C(=O)N1 |
| InChI | InChI=1S/C30H41N7O7/c1-43-29(41)23-12-13-26(38)31-14-15-37-18-22(35-36-37)17-25(34-30(42)44-19-21-10-6-3-7-11-21)28(40)33-24(27(39)32-23)16-20-8-4-2-5-9-20/h3,6-7,10-11,18,20,23-25H,2,4-5,8-9,12-17,19H2,1H3,(H,31,38)(H,32,39)(H,33,40)(H,34,42)/t23-,24-,25-/m0/s1 |
| InChIKey | HOJTXXMTGRLICJ-SDHOMARFSA-N |
| XLogP | 1.14 |
| TPSA | 182.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.70 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |