C22H25BrN10O2 — CID 127046820
N-[[(1S,2R,3R,4S)-2,3-bis(2-amino-1H-imidazol-5-yl)-4-[(1H-pyrrole-2-carbonylamino)methyl]cyclobutyl]methyl]-4-bromo-1H-pyrrole-2-carboxamide (PubChem CID 127046820) has the molecular formula C22H25BrN10O2 and a molecular weight of 541.41 g/mol. Its IUPAC name is N-[[(1S,2R,3R,4S)-2,3-bis(2-amino-1H-imidazol-5-yl)-4-[(1H-pyrrole-2-carbonylamino)methyl]cyclobutyl]methyl]-4-bromo-1H-pyrrole-2-carboxamide.
| Compound Name | N-[[(1S,2R,3R,4S)-2,3-bis(2-amino-1H-imidazol-5-yl)-4-[(1H-pyrrole-2-carbonylamino)methyl]cyclobutyl]methyl]-4-bromo-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 127046820 |
| Molecular Formula | C22H25BrN10O2 |
| Molecular Weight | 541.41 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | N-[[(1S,2R,3R,4S)-2,3-bis(2-amino-1H-imidazol-5-yl)-4-[(1H-pyrrole-2-carbonylamino)methyl]cyclobutyl]methyl]-4-bromo-1H-pyrrole-2-carboxamide |
| SMILES | Nc1ncc([C@@H]2[C@@H](CNC(=O)c3ccc[nH]3)[C@H](CNC(=O)c3cc(Br)c[nH]3)[C@H]2c2cnc(N)[nH]2)[nH]1 |
| InChI | InChI=1S/C22H25BrN10O2/c23-10-4-14(27-5-10)20(35)29-7-12-11(6-28-19(34)13-2-1-3-26-13)17(15-8-30-21(24)32-15)18(12)16-9-31-22(25)33-16/h1-5,8-9,11-12,17-18,26-27H,6-7H2,(H,28,34)(H,29,35)(H3,24,30,32)(H3,25,31,33)/t11-,12-,17-,18-/m0/s1 |
| InChIKey | OHXDZYOSEDUXGN-BMEPFDOTSA-N |
| XLogP | 1.69 |
| TPSA | 199.18 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |