C24H28ClN3O — CID 127049127
2-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]-N-[2-(1H-indol-3-yl)ethyl]acetamide (PubChem CID 127049127) has the molecular formula C24H28ClN3O and a molecular weight of 409.96 g/mol. Its IUPAC name is 2-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]-N-[2-(1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]-N-[2-(1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 127049127 |
| Molecular Formula | C24H28ClN3O |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 2-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]-N-[2-(1H-indol-3-yl)ethyl]acetamide |
| SMILES | O=C(CC1CCN(Cc2ccccc2Cl)CC1)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H28ClN3O/c25-22-7-3-1-5-20(22)17-28-13-10-18(11-14-28)15-24(29)26-12-9-19-16-27-23-8-4-2-6-21(19)23/h1-8,16,18,27H,9-15,17H2,(H,26,29) |
| InChIKey | PZQXXBORCKVRAX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |