C23H27FN4O2S — CID 127049865
5-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butoxy]-2-fluoro-N-methylbenzamide (PubChem CID 127049865) has the molecular formula C23H27FN4O2S and a molecular weight of 442.56 g/mol. Its IUPAC name is 5-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butoxy]-2-fluoro-N-methylbenzamide.
| Compound Name | 5-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butoxy]-2-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 127049865 |
| Molecular Formula | C23H27FN4O2S |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 5-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butoxy]-2-fluoro-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(OCCCCN2CCN(c3nsc4ccccc34)CC2)ccc1F |
| InChI | InChI=1S/C23H27FN4O2S/c1-25-23(29)19-16-17(8-9-20(19)24)30-15-5-4-10-27-11-13-28(14-12-27)22-18-6-2-3-7-21(18)31-26-22/h2-3,6-9,16H,4-5,10-15H2,1H3,(H,25,29) |
| InChIKey | UWKPCCXPIUTYOC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|