C23H29ClN4O2S — CID 45263962
N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-4-methoxybenzamide;hydrochloride (PubChem CID 45263962) has the molecular formula C23H29ClN4O2S and a molecular weight of 461.03 g/mol. Its IUPAC name is N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-4-methoxybenzamide;hydrochloride.
| Compound Name | N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-4-methoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 45263962 |
| Molecular Formula | C23H29ClN4O2S |
| Molecular Weight | 461.03 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-4-methoxybenzamide;hydrochloride |
| SMILES | COc1ccc(C(=O)NCCCCN2CCN(c3nsc4ccccc34)CC2)cc1.Cl |
| InChI | InChI=1S/C23H28N4O2S.ClH/c1-29-19-10-8-18(9-11-19)23(28)24-12-4-5-13-26-14-16-27(17-15-26)22-20-6-2-3-7-21(20)30-25-22;/h2-3,6-11H,4-5,12-17H2,1H3,(H,24,28);1H |
| InChIKey | RDJLUBNFHWKGID-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.03 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|